C17H24F3N3O2 — CID 166604259
tert-butyl 4-[4-(aminomethyl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 166604259) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is tert-butyl 4-[4-(aminomethyl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(aminomethyl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166604259 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | tert-butyl 4-[4-(aminomethyl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(CN)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-16(2,3)25-15(24)23-8-6-22(7-9-23)14-5-4-12(11-21)10-13(14)17(18,19)20/h4-5,10H,6-9,11,21H2,1-3H3 |
| InChIKey | PDKVEPMROULVRY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |