C24H30F3N3O2 — CID 167174425
tert-butyl 4-[4-(2-phenylethylamino)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 167174425) has the molecular formula C24H30F3N3O2 and a molecular weight of 449.52 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-phenylethylamino)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-phenylethylamino)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167174425 |
| Molecular Formula | C24H30F3N3O2 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | tert-butyl 4-[4-(2-phenylethylamino)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NCCc3ccccc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H30F3N3O2/c1-23(2,3)32-22(31)30-15-13-29(14-16-30)21-10-9-19(17-20(21)24(25,26)27)28-12-11-18-7-5-4-6-8-18/h4-10,17,28H,11-16H2,1-3H3 |
| InChIKey | DINHHRVGAJMGAJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|