C40H48F6N4O6 — CID 175195165
benzyl 3,4-bis[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 175195165) has the molecular formula C40H48F6N4O6 and a molecular weight of 794.83 g/mol. Its IUPAC name is benzyl 3,4-bis[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 3,4-bis[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175195165 |
| Molecular Formula | C40H48F6N4O6 |
| Molecular Weight | 794.83 g/mol |
| Exact Mass | 794.35 |
| IUPAC Name | benzyl 3,4-bis[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(C2CN(C(=O)OCc3ccccc3)CCN2c2ccc(CCNC(=O)OC(C)(C)C)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C40H48F6N4O6/c1-37(2,3)55-34(51)47-18-16-26-12-14-29(30(22-26)39(41,42)43)33-24-49(36(53)54-25-28-10-8-7-9-11-28)20-21-50(33)32-15-13-27(23-31(32)40(44,45)46)17-19-48-35(52)56-38(4,5)6/h7-15,22-23,33H,16-21,24-25H2,1-6H3,(H,47,51)(H,48,52) |
| InChIKey | QANPCUACWDYNTL-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.83 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|