C25H32F3N3O2 — CID 130303205
tert-butyl N-[2-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]ethyl]carbamate (PubChem CID 130303205) has the molecular formula C25H32F3N3O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 130303205 |
| Molecular Formula | C25H32F3N3O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | tert-butyl N-[2-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(N2CCN(Cc3ccccc3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H32F3N3O2/c1-24(2,3)33-23(32)29-12-11-19-9-10-22(21(17-19)25(26,27)28)31-15-13-30(14-16-31)18-20-7-5-4-6-8-20/h4-10,17H,11-16,18H2,1-3H3,(H,29,32) |
| InChIKey | PFOIKWKDYGYSQI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |