C24H39N3O2 — CID 18430867
tert-butyl N-[[1-[(4-benzylpiperazin-1-yl)methyl]cyclohexyl]methyl]carbamate (PubChem CID 18430867) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is tert-butyl N-[[1-[(4-benzylpiperazin-1-yl)methyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(4-benzylpiperazin-1-yl)methyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 18430867 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | tert-butyl N-[[1-[(4-benzylpiperazin-1-yl)methyl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(CN2CCN(Cc3ccccc3)CC2)CCCCC1 |
| InChI | InChI=1S/C24H39N3O2/c1-23(2,3)29-22(28)25-19-24(12-8-5-9-13-24)20-27-16-14-26(15-17-27)18-21-10-6-4-7-11-21/h4,6-7,10-11H,5,8-9,12-20H2,1-3H3,(H,25,28) |
| InChIKey | MCRRNLMVBZZTCG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |