C23H31N3O2 — CID 127264024
tert-butyl N-[(1-benzyl-4-pyridin-2-ylpiperidin-4-yl)methyl]carbamate (PubChem CID 127264024) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl N-[(1-benzyl-4-pyridin-2-ylpiperidin-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(1-benzyl-4-pyridin-2-ylpiperidin-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 127264024 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | tert-butyl N-[(1-benzyl-4-pyridin-2-ylpiperidin-4-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(c2ccccn2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O2/c1-22(2,3)28-21(27)25-18-23(20-11-7-8-14-24-20)12-15-26(16-13-23)17-19-9-5-4-6-10-19/h4-11,14H,12-13,15-18H2,1-3H3,(H,25,27) |
| InChIKey | YBEQOHROOPTJSY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |