C20H33NO3 — CID 177011643
tert-butyl 2-(1-benzyl-4-hydroxypiperidin-4-yl)acetate;ethane (PubChem CID 177011643) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is tert-butyl 2-(1-benzyl-4-hydroxypiperidin-4-yl)acetate;ethane.
| Compound Name | tert-butyl 2-(1-benzyl-4-hydroxypiperidin-4-yl)acetate;ethane |
|---|---|
| PubChem CID | 177011643 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | tert-butyl 2-(1-benzyl-4-hydroxypiperidin-4-yl)acetate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)CC1(O)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27NO3.C2H6/c1-17(2,3)22-16(20)13-18(21)9-11-19(12-10-18)14-15-7-5-4-6-8-15;1-2/h4-8,21H,9-14H2,1-3H3;1-2H3 |
| InChIKey | YFEASGUGYDWBOL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |