C18H27NO7 — CID 171659293
tert-butyl 2-(1-benzyl-3,3,4,5,5-pentahydroxypiperidin-4-yl)acetate (PubChem CID 171659293) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is tert-butyl 2-(1-benzyl-3,3,4,5,5-pentahydroxypiperidin-4-yl)acetate.
| Compound Name | tert-butyl 2-(1-benzyl-3,3,4,5,5-pentahydroxypiperidin-4-yl)acetate |
|---|---|
| PubChem CID | 171659293 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | tert-butyl 2-(1-benzyl-3,3,4,5,5-pentahydroxypiperidin-4-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)C(O)(O)CN(Cc2ccccc2)CC1(O)O |
| InChI | InChI=1S/C18H27NO7/c1-15(2,3)26-14(20)9-16(21)17(22,23)11-19(12-18(16,24)25)10-13-7-5-4-6-8-13/h4-8,21-25H,9-12H2,1-3H3 |
| InChIKey | XGAVONQMAJPKPZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|