C21H24ClNO2 — CID 168835329
tert-butyl 1-benzyl-3-(3-chlorophenyl)azetidine-3-carboxylate (PubChem CID 168835329) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is tert-butyl 1-benzyl-3-(3-chlorophenyl)azetidine-3-carboxylate.
| Compound Name | tert-butyl 1-benzyl-3-(3-chlorophenyl)azetidine-3-carboxylate |
|---|---|
| PubChem CID | 168835329 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | tert-butyl 1-benzyl-3-(3-chlorophenyl)azetidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(c2cccc(Cl)c2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H24ClNO2/c1-20(2,3)25-19(24)21(17-10-7-11-18(22)12-17)14-23(15-21)13-16-8-5-4-6-9-16/h4-12H,13-15H2,1-3H3 |
| InChIKey | LCZFINAHBKVVJZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |