C19H27F3N2O3 — CID 145278901
tert-butyl N-[1-[4-(methoxymethyl)-2-(trifluoromethyl)phenyl]piperidin-4-yl]carbamate (PubChem CID 145278901) has the molecular formula C19H27F3N2O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(methoxymethyl)-2-(trifluoromethyl)phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(methoxymethyl)-2-(trifluoromethyl)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 145278901 |
| Molecular Formula | C19H27F3N2O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | tert-butyl N-[1-[4-(methoxymethyl)-2-(trifluoromethyl)phenyl]piperidin-4-yl]carbamate |
| SMILES | COCc1ccc(N2CCC(NC(=O)OC(C)(C)C)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H27F3N2O3/c1-18(2,3)27-17(25)23-14-7-9-24(10-8-14)16-6-5-13(12-26-4)11-15(16)19(20,21)22/h5-6,11,14H,7-10,12H2,1-4H3,(H,23,25) |
| InChIKey | FKUTWPMHSSEBBM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |