C16H20ClF3N2O2 — CID 175141152
tert-butyl N-[1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate (PubChem CID 175141152) has the molecular formula C16H20ClF3N2O2 and a molecular weight of 364.80 g/mol. Its IUPAC name is tert-butyl N-[1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 175141152 |
| Molecular Formula | C16H20ClF3N2O2 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | tert-butyl N-[1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C16H20ClF3N2O2/c1-15(2,3)24-14(23)21-11-6-7-22(9-11)13-5-4-10(8-12(13)17)16(18,19)20/h4-5,8,11H,6-7,9H2,1-3H3,(H,21,23) |
| InChIKey | AWBYLFJWVIXOIL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |