C14H20ClN3O2 — CID 121204853
tert-butyl N-[1-(2-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate (PubChem CID 121204853) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is tert-butyl N-[1-(2-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 121204853 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | tert-butyl N-[1-(2-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccnc(Cl)c2)C1 |
| InChI | InChI=1S/C14H20ClN3O2/c1-14(2,3)20-13(19)17-10-5-7-18(9-10)11-4-6-16-12(15)8-11/h4,6,8,10H,5,7,9H2,1-3H3,(H,17,19) |
| InChIKey | PXBJVFMKATVSFR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|