C14H21ClN4O2 — CID 71634263
tert-butyl N-[(3S)-1-(2-chloro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 71634263) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(2-chloro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(2-chloro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 71634263 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | tert-butyl N-[(3S)-1-(2-chloro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | Cc1cc(N2CC[C@H](NC(=O)OC(C)(C)C)C2)nc(Cl)n1 |
| InChI | InChI=1S/C14H21ClN4O2/c1-9-7-11(18-12(15)16-9)19-6-5-10(8-19)17-13(20)21-14(2,3)4/h7,10H,5-6,8H2,1-4H3,(H,17,20)/t10-/m0/s1 |
| InChIKey | WUOZUKMZJICYJI-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |