C14H22ClN5O2 — CID 51119765
tert-butyl N-[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-4-yl]carbamate (PubChem CID 51119765) has the molecular formula C14H22ClN5O2 and a molecular weight of 327.82 g/mol. Its IUPAC name is tert-butyl N-[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 51119765 |
| Molecular Formula | C14H22ClN5O2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl N-[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2cc(Cl)nc(N)n2)CC1 |
| InChI | InChI=1S/C14H22ClN5O2/c1-14(2,3)22-13(21)17-9-4-6-20(7-5-9)11-8-10(15)18-12(16)19-11/h8-9H,4-7H2,1-3H3,(H,17,21)(H2,16,18,19) |
| InChIKey | YIODCXAUGRXMQB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |