C17H27ClN4O3 — CID 175640181
tert-butyl N-[1-(6-chloro-2-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]carbamate (PubChem CID 175640181) has the molecular formula C17H27ClN4O3 and a molecular weight of 370.88 g/mol. Its IUPAC name is tert-butyl N-[1-(6-chloro-2-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-chloro-2-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 175640181 |
| Molecular Formula | C17H27ClN4O3 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | tert-butyl N-[1-(6-chloro-2-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]carbamate |
| SMILES | CC(C)Oc1nc(Cl)cc(N2CCC(NC(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C17H27ClN4O3/c1-11(2)24-15-20-13(18)10-14(21-15)22-8-6-12(7-9-22)19-16(23)25-17(3,4)5/h10-12H,6-9H2,1-5H3,(H,19,23) |
| InChIKey | JPSZVFGFXAMSMD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |