C19H30ClN3O3 — CID 177282726
tert-butyl N-[1-(4-butoxy-6-chloro-2-pyridinyl)piperidin-4-yl]carbamate (PubChem CID 177282726) has the molecular formula C19H30ClN3O3 and a molecular weight of 383.92 g/mol. Its IUPAC name is tert-butyl N-[1-(4-butoxy-6-chloro-2-pyridinyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-butoxy-6-chloro-2-pyridinyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 177282726 |
| Molecular Formula | C19H30ClN3O3 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | tert-butyl N-[1-(4-butoxy-6-chloro-2-pyridinyl)piperidin-4-yl]carbamate |
| SMILES | CCCCOc1cc(Cl)nc(N2CCC(NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H30ClN3O3/c1-5-6-11-25-15-12-16(20)22-17(13-15)23-9-7-14(8-10-23)21-18(24)26-19(2,3)4/h12-14H,5-11H2,1-4H3,(H,21,24) |
| InChIKey | JTEKFEYWXQKLCF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|