C23H35F2N3O4 — CID 142387204
tert-butyl N-[1-[2-amino-3-(4-butoxyphenyl)-3,3-difluoropropanoyl]piperidin-4-yl]carbamate (PubChem CID 142387204) has the molecular formula C23H35F2N3O4 and a molecular weight of 455.55 g/mol. Its IUPAC name is tert-butyl N-[1-[2-amino-3-(4-butoxyphenyl)-3,3-difluoropropanoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-amino-3-(4-butoxyphenyl)-3,3-difluoropropanoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142387204 |
| Molecular Formula | C23H35F2N3O4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | tert-butyl N-[1-[2-amino-3-(4-butoxyphenyl)-3,3-difluoropropanoyl]piperidin-4-yl]carbamate |
| SMILES | CCCCOc1ccc(C(F)(F)C(N)C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H35F2N3O4/c1-5-6-15-31-18-9-7-16(8-10-18)23(24,25)19(26)20(29)28-13-11-17(12-14-28)27-21(30)32-22(2,3)4/h7-10,17,19H,5-6,11-15,26H2,1-4H3,(H,27,30) |
| InChIKey | LZPRKAQYGCFCBF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|