C26H34FN3O4 — CID 58866916
tert-butyl N-[1-[4-[(4-butoxybenzoyl)amino]-2-fluorophenyl]pyrrolidin-3-yl]carbamate (PubChem CID 58866916) has the molecular formula C26H34FN3O4 and a molecular weight of 471.57 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(4-butoxybenzoyl)amino]-2-fluorophenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(4-butoxybenzoyl)amino]-2-fluorophenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58866916 |
| Molecular Formula | C26H34FN3O4 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | tert-butyl N-[1-[4-[(4-butoxybenzoyl)amino]-2-fluorophenyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCC(NC(=O)OC(C)(C)C)C3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H34FN3O4/c1-5-6-15-33-21-10-7-18(8-11-21)24(31)28-19-9-12-23(22(27)16-19)30-14-13-20(17-30)29-25(32)34-26(2,3)4/h7-12,16,20H,5-6,13-15,17H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | UMPNNDUQFDSABU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|