C22H25FN2O3 — CID 55890047
N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 55890047) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55890047 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(F)c1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H25FN2O3/c23-20-14-17(7-10-21(20)25-11-1-2-12-25)24-22(26)16-5-8-18(9-6-16)28-15-19-4-3-13-27-19/h5-10,14,19H,1-4,11-13,15H2,(H,24,26) |
| InChIKey | JMVYCOMZWWIXRJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|