C16H22FN3O2 — CID 94167086
1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 94167086) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 94167086 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1CCCO1)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C16H22FN3O2/c17-14-10-12(5-6-15(14)20-7-1-2-8-20)19-16(21)18-11-13-4-3-9-22-13/h5-6,10,13H,1-4,7-9,11H2,(H2,18,19,21)/t13-/m1/s1 |
| InChIKey | SYNKRTDLVISYSD-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|