C25H32N4O3S — CID 3889646
5-[(4-methylsulfanylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide (PubChem CID 3889646) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is 5-[(4-methylsulfanylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(4-methylsulfanylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3889646 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 5-[(4-methylsulfanylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide |
| SMILES | CSc1ccc(NC(=O)Nc2ccc(N3CCCCC3)c(C(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C25H32N4O3S/c1-33-21-10-7-18(8-11-21)27-25(31)28-19-9-12-23(29-13-3-2-4-14-29)22(16-19)24(30)26-17-20-6-5-15-32-20/h7-12,16,20H,2-6,13-15,17H2,1H3,(H,26,30)(H2,27,28,31) |
| InChIKey | CBTSXULVRVLHQX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|