C28H40FN3O4 — CID 159589236
tert-butyl N-[1-[4-[(4-butoxybenzoyl)-methylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate;molecular hydrogen (PubChem CID 159589236) has the molecular formula C28H40FN3O4 and a molecular weight of 501.64 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(4-butoxybenzoyl)-methylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[1-[4-[(4-butoxybenzoyl)-methylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate;molecular hydrogen |
|---|---|
| PubChem CID | 159589236 |
| Molecular Formula | C28H40FN3O4 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | tert-butyl N-[1-[4-[(4-butoxybenzoyl)-methylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate;molecular hydrogen |
| SMILES | CCCCOc1ccc(C(=O)N(C)c2ccc(N3CCC(N(C)C(=O)OC(C)(C)C)C3)c(F)c2)cc1.[H][H] |
| InChI | InChI=1S/C28H38FN3O4.H2/c1-7-8-17-35-23-12-9-20(10-13-23)26(33)30(5)21-11-14-25(24(29)18-21)32-16-15-22(19-32)31(6)27(34)36-28(2,3)4;/h9-14,18,22H,7-8,15-17,19H2,1-6H3;1H |
| InChIKey | MKAHCRGRJWLMNY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|