C30H42FN3O4 — CID 58866556
tert-butyl N-[1-[4-[(4-butoxybenzoyl)-propan-2-ylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate (PubChem CID 58866556) has the molecular formula C30H42FN3O4 and a molecular weight of 527.68 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(4-butoxybenzoyl)-propan-2-ylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[4-[(4-butoxybenzoyl)-propan-2-ylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58866556 |
| Molecular Formula | C30H42FN3O4 |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | tert-butyl N-[1-[4-[(4-butoxybenzoyl)-propan-2-ylamino]-2-fluorophenyl]pyrrolidin-3-yl]-N-methylcarbamate |
| SMILES | CCCCOc1ccc(C(=O)N(c2ccc(N3CCC(N(C)C(=O)OC(C)(C)C)C3)c(F)c2)C(C)C)cc1 |
| InChI | InChI=1S/C30H42FN3O4/c1-8-9-18-37-25-13-10-22(11-14-25)28(35)34(21(2)3)23-12-15-27(26(31)19-23)33-17-16-24(20-33)32(7)29(36)38-30(4,5)6/h10-15,19,21,24H,8-9,16-18,20H2,1-7H3 |
| InChIKey | HYASGRJZUFWVHG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|