C28H41FN4O3 — CID 58867688
N-[4-[3-[(1-amino-1-hydroxy-4-methylpentan-2-yl)amino]pyrrolidin-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide (PubChem CID 58867688) has the molecular formula C28H41FN4O3 and a molecular weight of 500.66 g/mol. Its IUPAC name is N-[4-[3-[(1-amino-1-hydroxy-4-methylpentan-2-yl)amino]pyrrolidin-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide.
| Compound Name | N-[4-[3-[(1-amino-1-hydroxy-4-methylpentan-2-yl)amino]pyrrolidin-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 58867688 |
| Molecular Formula | C28H41FN4O3 |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | N-[4-[3-[(1-amino-1-hydroxy-4-methylpentan-2-yl)amino]pyrrolidin-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(C)c2ccc(N3CCC(NC(CC(C)C)C(N)O)C3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H41FN4O3/c1-5-6-15-36-23-10-7-20(8-11-23)28(35)32(4)22-9-12-26(24(29)17-22)33-14-13-21(18-33)31-25(27(30)34)16-19(2)3/h7-12,17,19,21,25,27,31,34H,5-6,13-16,18,30H2,1-4H3 |
| InChIKey | QLBJXNDQQIRWNN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|