C27H36FN3O2 — CID 59558080
N-[4-[(3aR,6aR)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide (PubChem CID 59558080) has the molecular formula C27H36FN3O2 and a molecular weight of 453.60 g/mol. Its IUPAC name is N-[4-[(3aR,6aR)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide.
| Compound Name | N-[4-[(3aR,6aR)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 59558080 |
| Molecular Formula | C27H36FN3O2 |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | N-[4-[(3aR,6aR)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(C)c2ccc(N3CC[C@@H]4CN(C(C)C)C[C@@H]43)c(F)c2)cc1 |
| InChI | InChI=1S/C27H36FN3O2/c1-5-6-15-33-23-10-7-20(8-11-23)27(32)29(4)22-9-12-25(24(28)16-22)31-14-13-21-17-30(19(2)3)18-26(21)31/h7-12,16,19,21,26H,5-6,13-15,17-18H2,1-4H3/t21-,26+/m1/s1 |
| InChIKey | NNLIURYPQITXQH-RLWLMLJZSA-N |
| XLogP | 5.20 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|