C28H41FN4O2 — CID 58867215
4-butoxy-N-[4-[3-[3-(dimethylamino)propyl-methylamino]pyrrolidin-1-yl]-3-fluorophenyl]-N-methylbenzamide (PubChem CID 58867215) has the molecular formula C28H41FN4O2 and a molecular weight of 484.66 g/mol. Its IUPAC name is 4-butoxy-N-[4-[3-[3-(dimethylamino)propyl-methylamino]pyrrolidin-1-yl]-3-fluorophenyl]-N-methylbenzamide.
| Compound Name | 4-butoxy-N-[4-[3-[3-(dimethylamino)propyl-methylamino]pyrrolidin-1-yl]-3-fluorophenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58867215 |
| Molecular Formula | C28H41FN4O2 |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 4-butoxy-N-[4-[3-[3-(dimethylamino)propyl-methylamino]pyrrolidin-1-yl]-3-fluorophenyl]-N-methylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(C)c2ccc(N3CCC(N(C)CCCN(C)C)C3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H41FN4O2/c1-6-7-19-35-25-12-9-22(10-13-25)28(34)32(5)23-11-14-27(26(29)20-23)33-18-15-24(21-33)31(4)17-8-16-30(2)3/h9-14,20,24H,6-8,15-19,21H2,1-5H3 |
| InChIKey | GGSTXCJUZPBTDW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|