C30H42FN3O3 — CID 59558100
N-[4-[(3aR,6aR)-5-(4-hydroxy-4-methylpentan-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide (PubChem CID 59558100) has the molecular formula C30H42FN3O3 and a molecular weight of 511.68 g/mol. Its IUPAC name is N-[4-[(3aR,6aR)-5-(4-hydroxy-4-methylpentan-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide.
| Compound Name | N-[4-[(3aR,6aR)-5-(4-hydroxy-4-methylpentan-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 59558100 |
| Molecular Formula | C30H42FN3O3 |
| Molecular Weight | 511.68 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | N-[4-[(3aR,6aR)-5-(4-hydroxy-4-methylpentan-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(C)c2ccc(N3CC[C@@H]4CN(C(C)CC(C)(C)O)C[C@@H]43)c(F)c2)cc1 |
| InChI | InChI=1S/C30H42FN3O3/c1-6-7-16-37-25-11-8-22(9-12-25)29(35)32(5)24-10-13-27(26(31)17-24)34-15-14-23-19-33(20-28(23)34)21(2)18-30(3,4)36/h8-13,17,21,23,28,36H,6-7,14-16,18-20H2,1-5H3/t21?,23-,28+/m1/s1 |
| InChIKey | YEJYNVPLXHROOQ-NNCGZRGQSA-N |
| XLogP | 5.34 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|