C30H42F2N6O6 — CID 161217893
tert-butyl N-[(3R)-1-(4-amino-2-fluorophenyl)pyrrolidin-3-yl]carbamate;tert-butyl N-[(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl]carbamate (PubChem CID 161217893) has the molecular formula C30H42F2N6O6 and a molecular weight of 620.70 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(4-amino-2-fluorophenyl)pyrrolidin-3-yl]carbamate;tert-butyl N-[(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(4-amino-2-fluorophenyl)pyrrolidin-3-yl]carbamate;tert-butyl N-[(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 161217893 |
| Molecular Formula | C30H42F2N6O6 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | tert-butyl N-[(3R)-1-(4-amino-2-fluorophenyl)pyrrolidin-3-yl]carbamate;tert-butyl N-[(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2ccc(N)cc2F)C1.CC(C)(C)OC(=O)N[C@@H]1CCN(c2ccc([N+](=O)[O-])cc2F)C1 |
| InChI | InChI=1S/C15H20FN3O4.C15H22FN3O2/c1-15(2,3)23-14(20)17-10-6-7-18(9-10)13-5-4-11(19(21)22)8-12(13)16;1-15(2,3)21-14(20)18-11-6-7-19(9-11)13-5-4-10(17)8-12(13)16/h4-5,8,10H,6-7,9H2,1-3H3,(H,17,20);4-5,8,11H,6-7,9,17H2,1-3H3,(H,18,20)/t10-;11-/m11/s1 |
| InChIKey | UXCPXSDUZKSTEC-ZQPRUIHHSA-N |
| XLogP | 5.35 |
| TPSA | 152.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|