C15H20FN3O4 — CID 91380231
[(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl] N-tert-butylcarbamate (PubChem CID 91380231) has the molecular formula C15H20FN3O4 and a molecular weight of 325.34 g/mol. Its IUPAC name is [(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl] N-tert-butylcarbamate.
| Compound Name | [(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91380231 |
| Molecular Formula | C15H20FN3O4 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | [(3R)-1-(2-fluoro-4-nitrophenyl)pyrrolidin-3-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@@H]1CCN(c2ccc([N+](=O)[O-])cc2F)C1 |
| InChI | InChI=1S/C15H20FN3O4/c1-15(2,3)17-14(20)23-11-6-7-18(9-11)13-5-4-10(19(21)22)8-12(13)16/h4-5,8,11H,6-7,9H2,1-3H3,(H,17,20)/t11-/m1/s1 |
| InChIKey | WXCBHETYJQKKJY-LLVKDONJSA-N |
| XLogP | 2.84 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|