C16H21FN4O4 — CID 175537838
[1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl] carbamate (PubChem CID 175537838) has the molecular formula C16H21FN4O4 and a molecular weight of 352.37 g/mol. Its IUPAC name is [1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl] carbamate.
| Compound Name | [1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175537838 |
| Molecular Formula | C16H21FN4O4 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl] carbamate |
| SMILES | NC(=O)OC1CCN(CC2CN(c3ccc([N+](=O)[O-])cc3F)C2)CC1 |
| InChI | InChI=1S/C16H21FN4O4/c17-14-7-12(21(23)24)1-2-15(14)20-9-11(10-20)8-19-5-3-13(4-6-19)25-16(18)22/h1-2,7,11,13H,3-6,8-10H2,(H2,18,22) |
| InChIKey | OTNXXPSHDVBNGT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|