C12H14FN3O2 — CID 176615798
3-(2-fluoro-4-nitrophenyl)-6-methyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 176615798) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 3-(2-fluoro-4-nitrophenyl)-6-methyl-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 3-(2-fluoro-4-nitrophenyl)-6-methyl-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 176615798 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-(2-fluoro-4-nitrophenyl)-6-methyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CN1C2CC1CN(c1ccc([N+](=O)[O-])cc1F)C2 |
| InChI | InChI=1S/C12H14FN3O2/c1-14-9-4-10(14)7-15(6-9)12-3-2-8(16(17)18)5-11(12)13/h2-3,5,9-10H,4,6-7H2,1H3 |
| InChIKey | QBELAKNSTPJHLH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|