C13H17FN2O4 — CID 176705419
3-(dimethoxymethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine (PubChem CID 176705419) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-(dimethoxymethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine.
| Compound Name | 3-(dimethoxymethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 176705419 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(dimethoxymethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine |
| SMILES | COC(OC)C1CCN(c2ccc([N+](=O)[O-])cc2F)C1 |
| InChI | InChI=1S/C13H17FN2O4/c1-19-13(20-2)9-5-6-15(8-9)12-4-3-10(16(17)18)7-11(12)14/h3-4,7,9,13H,5-6,8H2,1-2H3 |
| InChIKey | DXCAOZDHWRYUDG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|