C19H22FN3O4 — CID 133337514
N-(3,5-dimethoxyphenyl)-1-(2-fluoro-4-nitrophenyl)piperidin-4-amine (PubChem CID 133337514) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-(2-fluoro-4-nitrophenyl)piperidin-4-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-(2-fluoro-4-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 133337514 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-(2-fluoro-4-nitrophenyl)piperidin-4-amine |
| SMILES | COc1cc(NC2CCN(c3ccc([N+](=O)[O-])cc3F)CC2)cc(OC)c1 |
| InChI | InChI=1S/C19H22FN3O4/c1-26-16-9-14(10-17(12-16)27-2)21-13-5-7-22(8-6-13)19-4-3-15(23(24)25)11-18(19)20/h3-4,9-13,21H,5-8H2,1-2H3 |
| InChIKey | JVFVTQNBJXKVCZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|