C16H15FN2O3 — CID 133273552
2-(2-fluoro-4-nitrophenyl)-7-methoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 133273552) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-(2-fluoro-4-nitrophenyl)-7-methoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-fluoro-4-nitrophenyl)-7-methoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 133273552 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(2-fluoro-4-nitrophenyl)-7-methoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc2c(c1)CN(c1ccc([N+](=O)[O-])cc1F)CC2 |
| InChI | InChI=1S/C16H15FN2O3/c1-22-14-4-2-11-6-7-18(10-12(11)8-14)16-5-3-13(19(20)21)9-15(16)17/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | UWZQMSJYRFRVIY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|