C16H15Cl2NO — CID 69473036
2-(2,4-dichlorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 69473036) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2,4-dichlorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 69473036 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc2c(c1)CCN(c1ccc(Cl)cc1Cl)C2 |
| InChI | InChI=1S/C16H15Cl2NO/c1-20-14-4-2-12-10-19(7-6-11(12)8-14)16-5-3-13(17)9-15(16)18/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | HJLJDVNQUYFCNE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |