C20H25NO2 — CID 11573806
6,16-dimethoxy-11-methyl-11-azatricyclo[12.4.0.03,8]octadeca-1(14),3(8),4,6,15,17-hexaene (PubChem CID 11573806) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 6,16-dimethoxy-11-methyl-11-azatricyclo[12.4.0.03,8]octadeca-1(14),3(8),4,6,15,17-hexaene.
| Compound Name | 6,16-dimethoxy-11-methyl-11-azatricyclo[12.4.0.03,8]octadeca-1(14),3(8),4,6,15,17-hexaene |
|---|---|
| PubChem CID | 11573806 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 6,16-dimethoxy-11-methyl-11-azatricyclo[12.4.0.03,8]octadeca-1(14),3(8),4,6,15,17-hexaene |
| SMILES | COc1ccc2c(c1)CCN(C)CCc1cc(OC)ccc1C2 |
| InChI | InChI=1S/C20H25NO2/c1-21-10-8-17-13-19(22-2)6-4-15(17)12-16-5-7-20(23-3)14-18(16)9-11-21/h4-7,13-14H,8-12H2,1-3H3 |
| InChIKey | WZWHLVAXFSORKE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |