C13H18ClNO — CID 18176535
2-(3-chloropropyl)-6-methoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 18176535) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 2-(3-chloropropyl)-6-methoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3-chloropropyl)-6-methoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 18176535 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(3-chloropropyl)-6-methoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc2c(c1)CCN(CCCCl)C2 |
| InChI | InChI=1S/C13H18ClNO/c1-16-13-4-3-12-10-15(7-2-6-14)8-5-11(12)9-13/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | BMXKCEQOTUIWEB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|