C14H19NO — CID 23331357
7-methoxy-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 23331357) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 7-methoxy-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-methoxy-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 23331357 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 7-methoxy-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | C=CCN1CCc2ccc(OC)cc2CC1 |
| InChI | InChI=1S/C14H19NO/c1-3-8-15-9-6-12-4-5-14(16-2)11-13(12)7-10-15/h3-5,11H,1,6-10H2,2H3 |
| InChIKey | MHTGTIHMTACYDP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|