C13H19NOS — CID 89053369
3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol (PubChem CID 89053369) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol.
| Compound Name | 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 89053369 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol |
| SMILES | COc1ccc2c(c1)CN(CCCS)CC2 |
| InChI | InChI=1S/C13H19NOS/c1-15-13-4-3-11-5-7-14(6-2-8-16)10-12(11)9-13/h3-4,9,16H,2,5-8,10H2,1H3 |
| InChIKey | MSIOVXDYSBYOOY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|