About 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol
3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol (PubChem CID 89053369) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol.
Molecular Properties
| Compound Name | 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol |
| PubChem CID | 89053369 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol |
| SMILES | COc1ccc2c(c1)CN(CCCS)CC2 |
| InChI | InChI=1S/C13H19NOS/c1-15-13-4-3-11-5-7-14(6-2-8-16)10-12(11)9-13/h3-4,9,16H,2,5-8,10H2,1H3 |
| InChIKey | MSIOVXDYSBYOOY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol?
The IUPAC name of 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol (CID 89053369) is 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol.
What is the SMILES notation for 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol?
The canonical SMILES for 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol is COc1ccc2c(c1)CN(CCCS)CC2.
What is the InChIKey of 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol?
The InChIKey is MSIOVXDYSBYOOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NOS/c1-15-13-4-3-11-5-7-14(6-2-8-16)10-12(11)9-13/h3-4,9,16H,2,5-8,10H2,1H3.
What are the key properties of 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol?
3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol has a molecular weight of 237.37 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)propane-1-thiol is sourced from PubChem (CID 89053369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).