C15H22ClN — CID 62227824
2-(6-chlorohexyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 62227824) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is 2-(6-chlorohexyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(6-chlorohexyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 62227824 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-(6-chlorohexyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | ClCCCCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H22ClN/c16-10-5-1-2-6-11-17-12-9-14-7-3-4-8-15(14)13-17/h3-4,7-8H,1-2,5-6,9-13H2 |
| InChIKey | AYCQOJUDGXDHQA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|