C19H30BrN — CID 105343804
3-(9-bromononyl)-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 105343804) has the molecular formula C19H30BrN and a molecular weight of 352.36 g/mol. Its IUPAC name is 3-(9-bromononyl)-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-(9-bromononyl)-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 105343804 |
| Molecular Formula | C19H30BrN |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-(9-bromononyl)-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | BrCCCCCCCCCN1CCc2ccccc2CC1 |
| InChI | InChI=1S/C19H30BrN/c20-14-8-4-2-1-3-5-9-15-21-16-12-18-10-6-7-11-19(18)13-17-21/h6-7,10-11H,1-5,8-9,12-17H2 |
| InChIKey | HCFMWYKDBVFPRY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|