C14H18N2 — CID 60684058
5-(3,4-dihydro-1H-isoquinolin-2-yl)pentanenitrile (PubChem CID 60684058) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isoquinolin-2-yl)pentanenitrile.
| Compound Name | 5-(3,4-dihydro-1H-isoquinolin-2-yl)pentanenitrile |
|---|---|
| PubChem CID | 60684058 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 5-(3,4-dihydro-1H-isoquinolin-2-yl)pentanenitrile |
| SMILES | N#CCCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H18N2/c15-9-4-1-5-10-16-11-8-13-6-2-3-7-14(13)12-16/h2-3,6-7H,1,4-5,8,10-12H2 |
| InChIKey | WHRAYPCXYVUMNB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|