C17H28N2 — CID 55070080
4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)butan-1-amine (PubChem CID 55070080) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 55070080 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)butan-1-amine |
| SMILES | CC(C)CNCCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H28N2/c1-15(2)13-18-10-5-6-11-19-12-9-16-7-3-4-8-17(16)14-19/h3-4,7-8,15,18H,5-6,9-14H2,1-2H3 |
| InChIKey | TZRUYTYURGUNPI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|