About N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine (PubChem CID 62573872) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine.
Molecular Properties
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine |
| PubChem CID | 62573872 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine |
| SMILES | CCCCCNCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H26N2/c1-2-3-6-10-17-11-13-18-12-9-15-7-4-5-8-16(15)14-18/h4-5,7-8,17H,2-3,6,9-14H2,1H3 |
| InChIKey | FAMBRCWVYHMMMC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine?
The IUPAC name of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine (CID 62573872) is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine.
What is the SMILES notation for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine?
The canonical SMILES for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine is CCCCCNCCN1CCc2ccccc2C1.
What is the InChIKey of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine?
The InChIKey is FAMBRCWVYHMMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-2-3-6-10-17-11-13-18-12-9-15-7-4-5-8-16(15)14-18/h4-5,7-8,17H,2-3,6,9-14H2,1H3.
What are the key properties of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine?
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine has a molecular weight of 246.40 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pentan-1-amine is sourced from PubChem (CID 62573872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).