C21H35NO — CID 133083999
2-(2-decoxyethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 133083999) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 2-(2-decoxyethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-decoxyethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 133083999 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 2-(2-decoxyethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCCCCCCCCOCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H35NO/c1-2-3-4-5-6-7-8-11-17-23-18-16-22-15-14-20-12-9-10-13-21(20)19-22/h9-10,12-13H,2-8,11,14-19H2,1H3 |
| InChIKey | YMBRPJZWIQKDTJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|