C13H20N2O — CID 39244545
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]ethanamine (PubChem CID 39244545) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]ethanamine.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 39244545 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]ethanamine |
| SMILES | NCCOCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H20N2O/c14-6-9-16-10-8-15-7-5-12-3-1-2-4-13(12)11-15/h1-4H,5-11,14H2 |
| InChIKey | YYOBBUVEYJOYTF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|