C12H16NO3S- — CID 174785243
3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl sulfite (PubChem CID 174785243) has the molecular formula C12H16NO3S- and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl sulfite.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl sulfite |
|---|---|
| PubChem CID | 174785243 |
| Molecular Formula | C12H16NO3S- |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl sulfite |
| SMILES | O=S([O-])OCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C12H17NO3S/c14-17(15)16-9-3-7-13-8-6-11-4-1-2-5-12(11)10-13/h1-2,4-5H,3,6-10H2,(H,14,15)/p-1 |
| InChIKey | BVVYYITVEWJOHF-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|