About 3-pyrrolidin-1-ylpropyl sulfite
3-pyrrolidin-1-ylpropyl sulfite (PubChem CID 174785148) has the molecular formula C7H14NO3S-
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl sulfite.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-ylpropyl sulfite |
| PubChem CID | 174785148 |
| Molecular Formula | C7H14NO3S- |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl sulfite |
| SMILES | O=S([O-])OCCCN1CCCC1 |
| InChI | InChI=1S/C7H15NO3S/c9-12(10)11-7-3-6-8-4-1-2-5-8/h1-7H2,(H,9,10)/p-1 |
| InChIKey | OPDLRNMTDGTKCU-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrolidin-1-ylpropyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-ylpropyl sulfite?
The IUPAC name of 3-pyrrolidin-1-ylpropyl sulfite (CID 174785148) is 3-pyrrolidin-1-ylpropyl sulfite.
What is the SMILES notation for 3-pyrrolidin-1-ylpropyl sulfite?
The canonical SMILES for 3-pyrrolidin-1-ylpropyl sulfite is O=S([O-])OCCCN1CCCC1.
What is the InChIKey of 3-pyrrolidin-1-ylpropyl sulfite?
The InChIKey is OPDLRNMTDGTKCU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H15NO3S/c9-12(10)11-7-3-6-8-4-1-2-5-8/h1-7H2,(H,9,10)/p-1.
What are the key properties of 3-pyrrolidin-1-ylpropyl sulfite?
3-pyrrolidin-1-ylpropyl sulfite has a molecular weight of 192.26 g/mol, XLogP of 0.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-ylpropyl sulfite is sourced from PubChem (CID 174785148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).