About 4-piperazin-1-ylbutyl sulfite
4-piperazin-1-ylbutyl sulfite (PubChem CID 57144560) has the molecular formula C8H17N2O3S-
and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-piperazin-1-ylbutyl sulfite.
Molecular Properties
| Compound Name | 4-piperazin-1-ylbutyl sulfite |
| PubChem CID | 57144560 |
| Molecular Formula | C8H17N2O3S- |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-piperazin-1-ylbutyl sulfite |
| SMILES | O=S([O-])OCCCCN1CCNCC1 |
| InChI | InChI=1S/C8H18N2O3S/c11-14(12)13-8-2-1-5-10-6-3-9-4-7-10/h9H,1-8H2,(H,11,12)/p-1 |
| InChIKey | PRDCXQSKPAZENH-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-piperazin-1-ylbutyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-ylbutyl sulfite?
The IUPAC name of 4-piperazin-1-ylbutyl sulfite (CID 57144560) is 4-piperazin-1-ylbutyl sulfite.
What is the SMILES notation for 4-piperazin-1-ylbutyl sulfite?
The canonical SMILES for 4-piperazin-1-ylbutyl sulfite is O=S([O-])OCCCCN1CCNCC1.
What is the InChIKey of 4-piperazin-1-ylbutyl sulfite?
The InChIKey is PRDCXQSKPAZENH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18N2O3S/c11-14(12)13-8-2-1-5-10-6-3-9-4-7-10/h9H,1-8H2,(H,11,12)/p-1.
What are the key properties of 4-piperazin-1-ylbutyl sulfite?
4-piperazin-1-ylbutyl sulfite has a molecular weight of 221.30 g/mol, XLogP of -0.52, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-ylbutyl sulfite is sourced from PubChem (CID 57144560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).