About azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite
azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite (PubChem CID 174892913) has the molecular formula C8H20N3O4S-
and a molecular weight of 254.33 g/mol. Its IUPAC name is azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite.
Molecular Properties
| Compound Name | azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite |
| PubChem CID | 174892913 |
| Molecular Formula | C8H20N3O4S- |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite |
| SMILES | N.O=S([O-])OCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C8H18N2O4S.H3N/c11-7-5-9-1-3-10(4-2-9)6-8-14-15(12)13;/h11H,1-8H2,(H,12,13);1H3/p-1 |
| InChIKey | APHHFDUAVSCVLZ-UHFFFAOYSA-M |
| XLogP | -1.43 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite?
The IUPAC name of azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite (CID 174892913) is azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite.
What is the SMILES notation for azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite?
The canonical SMILES for azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite is N.O=S([O-])OCCN1CCN(CCO)CC1.
What is the InChIKey of azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite?
The InChIKey is APHHFDUAVSCVLZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18N2O4S.H3N/c11-7-5-9-1-3-10(4-2-9)6-8-14-15(12)13;/h11H,1-8H2,(H,12,13);1H3/p-1.
What are the key properties of azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite?
azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite has a molecular weight of 254.33 g/mol, XLogP of -1.43, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl sulfite is sourced from PubChem (CID 174892913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).